About ethane;5-ethyl-3-prop-2-enoxy-1,2-oxazole;propane
ethane;5-ethyl-3-prop-2-enoxy-1,2-oxazole;propane (PubChem CID 170613830) has the molecular formula C13H25NO2
and a molecular weight of 227.35 g/mol. Its IUPAC name is ethane;5-ethyl-3-prop-2-enoxy-1,2-oxazole;propane.
Molecular Properties
| Compound Name | ethane;5-ethyl-3-prop-2-enoxy-1,2-oxazole;propane |
| PubChem CID | 170613830 |
| Molecular Formula | C13H25NO2 |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.19 |
| IUPAC Name | ethane;5-ethyl-3-prop-2-enoxy-1,2-oxazole;propane |
| SMILES | C=CCOc1cc(CC)on1.CC.CCC |
| InChI | InChI=1S/C8H11NO2.C3H8.C2H6/c1-3-5-10-8-6-7(4-2)11-9-8;1-3-2;1-2/h3,6H,1,4-5H2,2H3;3H2,1-2H3;1-2H3 |
| InChIKey | RLNKPPNIYRPAKH-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;5-ethyl-3-prop-2-enoxy-1,2-oxazole;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-ethyl-3-prop-2-enoxy-1,2-oxazole;propane?
The IUPAC name of ethane;5-ethyl-3-prop-2-enoxy-1,2-oxazole;propane (CID 170613830) is ethane;5-ethyl-3-prop-2-enoxy-1,2-oxazole;propane.
What is the SMILES notation for ethane;5-ethyl-3-prop-2-enoxy-1,2-oxazole;propane?
The canonical SMILES for ethane;5-ethyl-3-prop-2-enoxy-1,2-oxazole;propane is C=CCOc1cc(CC)on1.CC.CCC.
What is the InChIKey of ethane;5-ethyl-3-prop-2-enoxy-1,2-oxazole;propane?
The InChIKey is RLNKPPNIYRPAKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO2.C3H8.C2H6/c1-3-5-10-8-6-7(4-2)11-9-8;1-3-2;1-2/h3,6H,1,4-5H2,2H3;3H2,1-2H3;1-2H3.
What are the key properties of ethane;5-ethyl-3-prop-2-enoxy-1,2-oxazole;propane?
ethane;5-ethyl-3-prop-2-enoxy-1,2-oxazole;propane has a molecular weight of 227.35 g/mol, XLogP of 4.24, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-ethyl-3-prop-2-enoxy-1,2-oxazole;propane is sourced from PubChem (CID 170613830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).