About (1-chloroisoquinolin-6-yl) hypofluorite;cyclohexane;methanol
(1-chloroisoquinolin-6-yl) hypofluorite;cyclohexane;methanol (PubChem CID 170614551) has the molecular formula C16H21ClFNO2
and a molecular weight of 313.80 g/mol. Its IUPAC name is (1-chloroisoquinolin-6-yl) hypofluorite;cyclohexane;methanol.
Molecular Properties
| Compound Name | (1-chloroisoquinolin-6-yl) hypofluorite;cyclohexane;methanol |
| PubChem CID | 170614551 |
| Molecular Formula | C16H21ClFNO2 |
| Molecular Weight | 313.80 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | (1-chloroisoquinolin-6-yl) hypofluorite;cyclohexane;methanol |
| SMILES | C1CCCCC1.CO.FOc1ccc2c(Cl)nccc2c1 |
| InChI | InChI=1S/C9H5ClFNO.C6H12.CH4O/c10-9-8-2-1-7(13-11)5-6(8)3-4-12-9;1-2-4-6-5-3-1;1-2/h1-5H;1-6H2;2H,1H3 |
| InChIKey | OYYZMUGLBJLDST-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 313.80 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze (1-chloroisoquinolin-6-yl) hypofluorite;cyclohexane;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-chloroisoquinolin-6-yl) hypofluorite;cyclohexane;methanol?
The IUPAC name of (1-chloroisoquinolin-6-yl) hypofluorite;cyclohexane;methanol (CID 170614551) is (1-chloroisoquinolin-6-yl) hypofluorite;cyclohexane;methanol.
What is the SMILES notation for (1-chloroisoquinolin-6-yl) hypofluorite;cyclohexane;methanol?
The canonical SMILES for (1-chloroisoquinolin-6-yl) hypofluorite;cyclohexane;methanol is C1CCCCC1.CO.FOc1ccc2c(Cl)nccc2c1.
What is the InChIKey of (1-chloroisoquinolin-6-yl) hypofluorite;cyclohexane;methanol?
The InChIKey is OYYZMUGLBJLDST-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5ClFNO.C6H12.CH4O/c10-9-8-2-1-7(13-11)5-6(8)3-4-12-9;1-2-4-6-5-3-1;1-2/h1-5H;1-6H2;2H,1H3.
What are the key properties of (1-chloroisoquinolin-6-yl) hypofluorite;cyclohexane;methanol?
(1-chloroisoquinolin-6-yl) hypofluorite;cyclohexane;methanol has a molecular weight of 313.80 g/mol, XLogP of 5.10, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-chloroisoquinolin-6-yl) hypofluorite;cyclohexane;methanol is sourced from PubChem (CID 170614551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).