C8H10F12O4 — CID 170615010
ethane;molecular hydrogen;1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2-tetrafluoro-2-hydroxyethoxy)ethoxy]ethanol (PubChem CID 170615010) has the molecular formula C8H10F12O4 and a molecular weight of 398.14 g/mol. Its IUPAC name is ethane;molecular hydrogen;1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2-tetrafluoro-2-hydroxyethoxy)ethoxy]ethanol.
| Compound Name | ethane;molecular hydrogen;1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2-tetrafluoro-2-hydroxyethoxy)ethoxy]ethanol |
|---|---|
| PubChem CID | 170615010 |
| Molecular Formula | C8H10F12O4 |
| Molecular Weight | 398.14 g/mol |
| Exact Mass | 398.04 |
| IUPAC Name | ethane;molecular hydrogen;1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2-tetrafluoro-2-hydroxyethoxy)ethoxy]ethanol |
| SMILES | CC.OC(F)(F)C(F)(F)OC(F)(F)C(F)(F)OC(F)(F)C(O)(F)F.[H][H] |
| InChI | InChI=1S/C6H2F12O4.C2H6.H2/c7-1(8,19)3(11,12)21-5(15,16)6(17,18)22-4(13,14)2(9,10)20;1-2;/h19-20H;1-2H3;1H |
| InChIKey | BWLHFIKFDSNEGR-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.14 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|