C20H17ClFN3O2 — CID 170615467
(11R,12S)-12-(2-chlorophenyl)-7-fluoro-11-[(3R)-oxolan-3-yl]-2,3,10-triazatricyclo[7.3.1.05,13]trideca-1,5(13),6,8-tetraen-4-one (PubChem CID 170615467) has the molecular formula C20H17ClFN3O2 and a molecular weight of 385.83 g/mol. Its IUPAC name is (11R,12S)-12-(2-chlorophenyl)-7-fluoro-11-[(3R)-oxolan-3-yl]-2,3,10-triazatricyclo[7.3.1.05,13]trideca-1,5(13),6,8-tetraen-4-one.
| Compound Name | (11R,12S)-12-(2-chlorophenyl)-7-fluoro-11-[(3R)-oxolan-3-yl]-2,3,10-triazatricyclo[7.3.1.05,13]trideca-1,5(13),6,8-tetraen-4-one |
|---|---|
| PubChem CID | 170615467 |
| Molecular Formula | C20H17ClFN3O2 |
| Molecular Weight | 385.83 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | (11R,12S)-12-(2-chlorophenyl)-7-fluoro-11-[(3R)-oxolan-3-yl]-2,3,10-triazatricyclo[7.3.1.05,13]trideca-1,5(13),6,8-tetraen-4-one |
| SMILES | O=c1[nH]nc2c3c(cc(F)cc13)N[C@@H]([C@H]1CCOC1)[C@@H]2c1ccccc1Cl |
| InChI | InChI=1S/C20H17ClFN3O2/c21-14-4-2-1-3-12(14)17-18(10-5-6-27-9-10)23-15-8-11(22)7-13-16(15)19(17)24-25-20(13)26/h1-4,7-8,10,17-18,23H,5-6,9H2,(H,25,26)/t10-,17-,18-/m0/s1 |
| InChIKey | VOYPNRVRDSVYTB-OXNYHJJDSA-N |
| XLogP | 3.68 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.83 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |