C17H17F2N3O3S — CID 170616376
6-tert-butylsulfonyl-3-(4,6-difluoro-2-pyridinyl)-7-methoxyimidazo[1,2-a]pyridine (PubChem CID 170616376) has the molecular formula C17H17F2N3O3S and a molecular weight of 381.40 g/mol. Its IUPAC name is 6-tert-butylsulfonyl-3-(4,6-difluoro-2-pyridinyl)-7-methoxyimidazo[1,2-a]pyridine.
| Compound Name | 6-tert-butylsulfonyl-3-(4,6-difluoro-2-pyridinyl)-7-methoxyimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 170616376 |
| Molecular Formula | C17H17F2N3O3S |
| Molecular Weight | 381.40 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | 6-tert-butylsulfonyl-3-(4,6-difluoro-2-pyridinyl)-7-methoxyimidazo[1,2-a]pyridine |
| SMILES | COc1cc2ncc(-c3cc(F)cc(F)n3)n2cc1S(=O)(=O)C(C)(C)C |
| InChI | InChI=1S/C17H17F2N3O3S/c1-17(2,3)26(23,24)14-9-22-12(8-20-16(22)7-13(14)25-4)11-5-10(18)6-15(19)21-11/h5-9H,1-4H3 |
| InChIKey | DSNVBZKPHSLDLA-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 73.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.40 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|