C18H19F2N3OS — CID 170616408
3-(6-tert-butylsulfanyl-7-methoxyimidazo[1,2-a]pyridin-3-yl)-2,6-difluoroaniline (PubChem CID 170616408) has the molecular formula C18H19F2N3OS and a molecular weight of 363.43 g/mol. Its IUPAC name is 3-(6-tert-butylsulfanyl-7-methoxyimidazo[1,2-a]pyridin-3-yl)-2,6-difluoroaniline.
| Compound Name | 3-(6-tert-butylsulfanyl-7-methoxyimidazo[1,2-a]pyridin-3-yl)-2,6-difluoroaniline |
|---|---|
| PubChem CID | 170616408 |
| Molecular Formula | C18H19F2N3OS |
| Molecular Weight | 363.43 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | 3-(6-tert-butylsulfanyl-7-methoxyimidazo[1,2-a]pyridin-3-yl)-2,6-difluoroaniline |
| SMILES | COc1cc2ncc(-c3ccc(F)c(N)c3F)n2cc1SC(C)(C)C |
| InChI | InChI=1S/C18H19F2N3OS/c1-18(2,3)25-14-9-23-12(8-22-15(23)7-13(14)24-4)10-5-6-11(19)17(21)16(10)20/h5-9H,21H2,1-4H3 |
| InChIKey | LEVHVCKMWXZMAR-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.43 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|