About 3-(6-tert-butylsulfanyl-7-methoxyimidazo[1,2-a]pyridin-3-yl)-2,6-difluoroaniline
3-(6-tert-butylsulfanyl-7-methoxyimidazo[1,2-a]pyridin-3-yl)-2,6-difluoroaniline (PubChem CID 170616408) has the molecular formula C18H19F2N3OS
and a molecular weight of 363.43 g/mol. Its IUPAC name is 3-(6-tert-butylsulfanyl-7-methoxyimidazo[1,2-a]pyridin-3-yl)-2,6-difluoroaniline.
Molecular Properties
| Compound Name | 3-(6-tert-butylsulfanyl-7-methoxyimidazo[1,2-a]pyridin-3-yl)-2,6-difluoroaniline |
| PubChem CID | 170616408 |
| Molecular Formula | C18H19F2N3OS |
| Molecular Weight | 363.43 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | 3-(6-tert-butylsulfanyl-7-methoxyimidazo[1,2-a]pyridin-3-yl)-2,6-difluoroaniline |
| SMILES | COc1cc2ncc(-c3ccc(F)c(N)c3F)n2cc1SC(C)(C)C |
| InChI | InChI=1S/C18H19F2N3OS/c1-18(2,3)25-14-9-23-12(8-22-15(23)7-13(14)24-4)10-5-6-11(19)17(21)16(10)20/h5-9H,21H2,1-4H3 |
| InChIKey | LEVHVCKMWXZMAR-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.43 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-(6-tert-butylsulfanyl-7-methoxyimidazo[1,2-a]pyridin-3-yl)-2,6-difluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(6-tert-butylsulfanyl-7-methoxyimidazo[1,2-a]pyridin-3-yl)-2,6-difluoroaniline?
The IUPAC name of 3-(6-tert-butylsulfanyl-7-methoxyimidazo[1,2-a]pyridin-3-yl)-2,6-difluoroaniline (CID 170616408) is 3-(6-tert-butylsulfanyl-7-methoxyimidazo[1,2-a]pyridin-3-yl)-2,6-difluoroaniline.
What is the SMILES notation for 3-(6-tert-butylsulfanyl-7-methoxyimidazo[1,2-a]pyridin-3-yl)-2,6-difluoroaniline?
The canonical SMILES for 3-(6-tert-butylsulfanyl-7-methoxyimidazo[1,2-a]pyridin-3-yl)-2,6-difluoroaniline is COc1cc2ncc(-c3ccc(F)c(N)c3F)n2cc1SC(C)(C)C.
What is the InChIKey of 3-(6-tert-butylsulfanyl-7-methoxyimidazo[1,2-a]pyridin-3-yl)-2,6-difluoroaniline?
The InChIKey is LEVHVCKMWXZMAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19F2N3OS/c1-18(2,3)25-14-9-23-12(8-22-15(23)7-13(14)24-4)10-5-6-11(19)17(21)16(10)20/h5-9H,21H2,1-4H3.
What are the key properties of 3-(6-tert-butylsulfanyl-7-methoxyimidazo[1,2-a]pyridin-3-yl)-2,6-difluoroaniline?
3-(6-tert-butylsulfanyl-7-methoxyimidazo[1,2-a]pyridin-3-yl)-2,6-difluoroaniline has a molecular weight of 363.43 g/mol, XLogP of 4.76, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(6-tert-butylsulfanyl-7-methoxyimidazo[1,2-a]pyridin-3-yl)-2,6-difluoroaniline is sourced from PubChem (CID 170616408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).