About 5-(6-tert-butylsulfonyl-7-methoxyimidazo[1,2-a]pyridin-3-yl)-3,6-difluoropyridin-2-amine
5-(6-tert-butylsulfonyl-7-methoxyimidazo[1,2-a]pyridin-3-yl)-3,6-difluoropyridin-2-amine (PubChem CID 170616445) has the molecular formula C17H18F2N4O3S
and a molecular weight of 396.42 g/mol. Its IUPAC name is 5-(6-tert-butylsulfonyl-7-methoxyimidazo[1,2-a]pyridin-3-yl)-3,6-difluoropyridin-2-amine.
Molecular Properties
| Compound Name | 5-(6-tert-butylsulfonyl-7-methoxyimidazo[1,2-a]pyridin-3-yl)-3,6-difluoropyridin-2-amine |
| PubChem CID | 170616445 |
| Molecular Formula | C17H18F2N4O3S |
| Molecular Weight | 396.42 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | 5-(6-tert-butylsulfonyl-7-methoxyimidazo[1,2-a]pyridin-3-yl)-3,6-difluoropyridin-2-amine |
| SMILES | COc1cc2ncc(-c3cc(F)c(N)nc3F)n2cc1S(=O)(=O)C(C)(C)C |
| InChI | InChI=1S/C17H18F2N4O3S/c1-17(2,3)27(24,25)13-8-23-11(7-21-14(23)6-12(13)26-4)9-5-10(18)16(20)22-15(9)19/h5-8H,1-4H3,(H2,20,22) |
| InChIKey | MFXSLCCCDUJALJ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 99.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.42 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 5-(6-tert-butylsulfonyl-7-methoxyimidazo[1,2-a]pyridin-3-yl)-3,6-difluoropyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(6-tert-butylsulfonyl-7-methoxyimidazo[1,2-a]pyridin-3-yl)-3,6-difluoropyridin-2-amine?
The IUPAC name of 5-(6-tert-butylsulfonyl-7-methoxyimidazo[1,2-a]pyridin-3-yl)-3,6-difluoropyridin-2-amine (CID 170616445) is 5-(6-tert-butylsulfonyl-7-methoxyimidazo[1,2-a]pyridin-3-yl)-3,6-difluoropyridin-2-amine.
What is the SMILES notation for 5-(6-tert-butylsulfonyl-7-methoxyimidazo[1,2-a]pyridin-3-yl)-3,6-difluoropyridin-2-amine?
The canonical SMILES for 5-(6-tert-butylsulfonyl-7-methoxyimidazo[1,2-a]pyridin-3-yl)-3,6-difluoropyridin-2-amine is COc1cc2ncc(-c3cc(F)c(N)nc3F)n2cc1S(=O)(=O)C(C)(C)C.
What is the InChIKey of 5-(6-tert-butylsulfonyl-7-methoxyimidazo[1,2-a]pyridin-3-yl)-3,6-difluoropyridin-2-amine?
The InChIKey is MFXSLCCCDUJALJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18F2N4O3S/c1-17(2,3)27(24,25)13-8-23-11(7-21-14(23)6-12(13)26-4)9-5-10(18)16(20)22-15(9)19/h5-8H,1-4H3,(H2,20,22).
What are the key properties of 5-(6-tert-butylsulfonyl-7-methoxyimidazo[1,2-a]pyridin-3-yl)-3,6-difluoropyridin-2-amine?
5-(6-tert-butylsulfonyl-7-methoxyimidazo[1,2-a]pyridin-3-yl)-3,6-difluoropyridin-2-amine has a molecular weight of 396.42 g/mol, XLogP of 2.84, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(6-tert-butylsulfonyl-7-methoxyimidazo[1,2-a]pyridin-3-yl)-3,6-difluoropyridin-2-amine is sourced from PubChem (CID 170616445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).