C19H22FN5O3 — CID 170616529
3-[2-fluoro-6-(3-hydroxypropylamino)-4-pyridinyl]-7-methoxy-N,N-dimethylimidazo[1,2-a]pyridine-6-carboxamide (PubChem CID 170616529) has the molecular formula C19H22FN5O3 and a molecular weight of 387.42 g/mol. Its IUPAC name is 3-[2-fluoro-6-(3-hydroxypropylamino)-4-pyridinyl]-7-methoxy-N,N-dimethylimidazo[1,2-a]pyridine-6-carboxamide.
| Compound Name | 3-[2-fluoro-6-(3-hydroxypropylamino)-4-pyridinyl]-7-methoxy-N,N-dimethylimidazo[1,2-a]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 170616529 |
| Molecular Formula | C19H22FN5O3 |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 3-[2-fluoro-6-(3-hydroxypropylamino)-4-pyridinyl]-7-methoxy-N,N-dimethylimidazo[1,2-a]pyridine-6-carboxamide |
| SMILES | COc1cc2ncc(-c3cc(F)nc(NCCCO)c3)n2cc1C(=O)N(C)C |
| InChI | InChI=1S/C19H22FN5O3/c1-24(2)19(27)13-11-25-14(10-22-18(25)9-15(13)28-3)12-7-16(20)23-17(8-12)21-5-4-6-26/h7-11,26H,4-6H2,1-3H3,(H,21,23) |
| InChIKey | PZSZARDHAIZGDK-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 91.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|