C23H34FN5O2S — CID 170616566
4-[(Z)-1-[[(1E)-2-tert-butylsulfinyl-3-methoxybuta-1,3-dienyl]amino]-2-(methylideneamino)ethenyl]-6-fluoro-N-(piperidin-4-ylmethyl)pyridin-2-amine (PubChem CID 170616566) has the molecular formula C23H34FN5O2S and a molecular weight of 463.62 g/mol. Its IUPAC name is 4-[(Z)-1-[[(1E)-2-tert-butylsulfinyl-3-methoxybuta-1,3-dienyl]amino]-2-(methylideneamino)ethenyl]-6-fluoro-N-(piperidin-4-ylmethyl)pyridin-2-amine.
| Compound Name | 4-[(Z)-1-[[(1E)-2-tert-butylsulfinyl-3-methoxybuta-1,3-dienyl]amino]-2-(methylideneamino)ethenyl]-6-fluoro-N-(piperidin-4-ylmethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 170616566 |
| Molecular Formula | C23H34FN5O2S |
| Molecular Weight | 463.62 g/mol |
| Exact Mass | 463.24 |
| IUPAC Name | 4-[(Z)-1-[[(1E)-2-tert-butylsulfinyl-3-methoxybuta-1,3-dienyl]amino]-2-(methylideneamino)ethenyl]-6-fluoro-N-(piperidin-4-ylmethyl)pyridin-2-amine |
| SMILES | C=N/C=C(\N/C=C(\C(=C)OC)S(=O)C(C)(C)C)c1cc(F)nc(NCC2CCNCC2)c1 |
| InChI | InChI=1S/C23H34FN5O2S/c1-16(31-6)20(32(30)23(2,3)4)15-27-19(14-25-5)18-11-21(24)29-22(12-18)28-13-17-7-9-26-10-8-17/h11-12,14-15,17,26-27H,1,5,7-10,13H2,2-4,6H3,(H,28,29)/b19-14-,20-15+ |
| InChIKey | MOWZSQKIRIVJGB-FANOUHKGSA-N |
| XLogP | 3.77 |
| TPSA | 87.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.62 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|