C17H35N3O — CID 170617031
ethane;1-[4-[(1-propan-2-ylpiperidin-4-yl)methyl]piperazin-1-yl]ethanone (PubChem CID 170617031) has the molecular formula C17H35N3O and a molecular weight of 297.49 g/mol. Its IUPAC name is ethane;1-[4-[(1-propan-2-ylpiperidin-4-yl)methyl]piperazin-1-yl]ethanone.
| Compound Name | ethane;1-[4-[(1-propan-2-ylpiperidin-4-yl)methyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 170617031 |
| Molecular Formula | C17H35N3O |
| Molecular Weight | 297.49 g/mol |
| Exact Mass | 297.28 |
| IUPAC Name | ethane;1-[4-[(1-propan-2-ylpiperidin-4-yl)methyl]piperazin-1-yl]ethanone |
| SMILES | CC.CC(=O)N1CCN(CC2CCN(C(C)C)CC2)CC1 |
| InChI | InChI=1S/C15H29N3O.C2H6/c1-13(2)17-6-4-15(5-7-17)12-16-8-10-18(11-9-16)14(3)19;1-2/h13,15H,4-12H2,1-3H3;1-2H3 |
| InChIKey | SSCVRFXYYCKUFN-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.49 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |