C13H27N3 — CID 170617047
1-methyl-4-[[(3S)-1-propan-2-ylpyrrolidin-3-yl]methyl]piperazine (PubChem CID 170617047) has the molecular formula C13H27N3 and a molecular weight of 225.38 g/mol. Its IUPAC name is 1-methyl-4-[[(3S)-1-propan-2-ylpyrrolidin-3-yl]methyl]piperazine.
| Compound Name | 1-methyl-4-[[(3S)-1-propan-2-ylpyrrolidin-3-yl]methyl]piperazine |
|---|---|
| PubChem CID | 170617047 |
| Molecular Formula | C13H27N3 |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.22 |
| IUPAC Name | 1-methyl-4-[[(3S)-1-propan-2-ylpyrrolidin-3-yl]methyl]piperazine |
| SMILES | CC(C)N1CC[C@@H](CN2CCN(C)CC2)C1 |
| InChI | InChI=1S/C13H27N3/c1-12(2)16-5-4-13(11-16)10-15-8-6-14(3)7-9-15/h12-13H,4-11H2,1-3H3/t13-/m0/s1 |
| InChIKey | DXLZVFDPVYPDIF-ZDUSSCGKSA-N |
| XLogP | 0.96 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |