C26H32N8O2S — CID 170618156
(17E)-5,8,10,13-tetramethyl-15-(1-methylsulfanylazetidin-3-yl)oxy-7-oxa-4,5,10,13,14,20,21-heptazapentacyclo[17.5.2.02,6.012,16.022,26]hexacosa-1(25),2(6),3,12(16),14,17,19(26),21,23-nonaene (PubChem CID 170618156) has the molecular formula C26H32N8O2S and a molecular weight of 520.66 g/mol. Its IUPAC name is (17E)-5,8,10,13-tetramethyl-15-(1-methylsulfanylazetidin-3-yl)oxy-7-oxa-4,5,10,13,14,20,21-heptazapentacyclo[17.5.2.02,6.012,16.022,26]hexacosa-1(25),2(6),3,12(16),14,17,19(26),21,23-nonaene.
| Compound Name | (17E)-5,8,10,13-tetramethyl-15-(1-methylsulfanylazetidin-3-yl)oxy-7-oxa-4,5,10,13,14,20,21-heptazapentacyclo[17.5.2.02,6.012,16.022,26]hexacosa-1(25),2(6),3,12(16),14,17,19(26),21,23-nonaene |
|---|---|
| PubChem CID | 170618156 |
| Molecular Formula | C26H32N8O2S |
| Molecular Weight | 520.66 g/mol |
| Exact Mass | 520.24 |
| IUPAC Name | (17E)-5,8,10,13-tetramethyl-15-(1-methylsulfanylazetidin-3-yl)oxy-7-oxa-4,5,10,13,14,20,21-heptazapentacyclo[17.5.2.02,6.012,16.022,26]hexacosa-1(25),2(6),3,12(16),14,17,19(26),21,23-nonaene |
| SMILES | CSN1CC(Oc2nn(C)c3c2/C=C/c2[nH]nc4ccc(cc24)-c2cnn(C)c2OC(C)CN(C)C3)C1 |
| InChI | InChI=1S/C26H32N8O2S/c1-16-12-31(2)15-24-19(25(30-32(24)3)36-18-13-34(14-18)37-5)7-9-23-20-10-17(6-8-22(20)28-29-23)21-11-27-33(4)26(21)35-16/h6-11,16,18H,12-15H2,1-5H3,(H,28,29)/b9-7+ |
| InChIKey | XRAJQEXUJMKVAC-VQHVLOKHSA-N |
| XLogP | 3.42 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.66 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|