About ethane;methane;[5-(2-methylsulfanylethyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-yl]methanol
ethane;methane;[5-(2-methylsulfanylethyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-yl]methanol (PubChem CID 170618264) has the molecular formula C13H27N3OS
and a molecular weight of 273.45 g/mol. Its IUPAC name is ethane;methane;[5-(2-methylsulfanylethyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-yl]methanol.
Molecular Properties
| Compound Name | ethane;methane;[5-(2-methylsulfanylethyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-yl]methanol |
| PubChem CID | 170618264 |
| Molecular Formula | C13H27N3OS |
| Molecular Weight | 273.45 g/mol |
| Exact Mass | 273.19 |
| IUPAC Name | ethane;methane;[5-(2-methylsulfanylethyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-yl]methanol |
| SMILES | C.CC.CSCCN1CCn2nc(CO)cc2C1 |
| InChI | InChI=1S/C10H17N3OS.C2H6.CH4/c1-15-5-4-12-2-3-13-10(7-12)6-9(8-14)11-13;1-2;/h6,14H,2-5,7-8H2,1H3;1-2H3;1H4 |
| InChIKey | BZTSQFAZPPWSPT-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.45 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethane;methane;[5-(2-methylsulfanylethyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methane;[5-(2-methylsulfanylethyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-yl]methanol?
The IUPAC name of ethane;methane;[5-(2-methylsulfanylethyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-yl]methanol (CID 170618264) is ethane;methane;[5-(2-methylsulfanylethyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-yl]methanol.
What is the SMILES notation for ethane;methane;[5-(2-methylsulfanylethyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-yl]methanol?
The canonical SMILES for ethane;methane;[5-(2-methylsulfanylethyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-yl]methanol is C.CC.CSCCN1CCn2nc(CO)cc2C1.
What is the InChIKey of ethane;methane;[5-(2-methylsulfanylethyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-yl]methanol?
The InChIKey is BZTSQFAZPPWSPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3OS.C2H6.CH4/c1-15-5-4-12-2-3-13-10(7-12)6-9(8-14)11-13;1-2;/h6,14H,2-5,7-8H2,1H3;1-2H3;1H4.
What are the key properties of ethane;methane;[5-(2-methylsulfanylethyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-yl]methanol?
ethane;methane;[5-(2-methylsulfanylethyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-yl]methanol has a molecular weight of 273.45 g/mol, XLogP of 2.22, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methane;[5-(2-methylsulfanylethyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-yl]methanol is sourced from PubChem (CID 170618264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).