C24H24N2O4S — CID 17061853
ethyl 2-benzamido-4-methyl-5-(1-phenylethylcarbamoyl)thiophene-3-carboxylate (PubChem CID 17061853) has the molecular formula C24H24N2O4S and a molecular weight of 436.53 g/mol. Its IUPAC name is ethyl 2-benzamido-4-methyl-5-(1-phenylethylcarbamoyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-benzamido-4-methyl-5-(1-phenylethylcarbamoyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 17061853 |
| Molecular Formula | C24H24N2O4S |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | ethyl 2-benzamido-4-methyl-5-(1-phenylethylcarbamoyl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)c2ccccc2)sc(C(=O)NC(C)c2ccccc2)c1C |
| InChI | InChI=1S/C24H24N2O4S/c1-4-30-24(29)19-15(2)20(22(28)25-16(3)17-11-7-5-8-12-17)31-23(19)26-21(27)18-13-9-6-10-14-18/h5-14,16H,4H2,1-3H3,(H,25,28)(H,26,27) |
| InChIKey | WDGUCKOAHBSWCX-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |