About decan-4-yl 4-chlorohexa-4,5-dienoate
decan-4-yl 4-chlorohexa-4,5-dienoate (PubChem CID 170618796) has the molecular formula C16H27ClO2
and a molecular weight of 286.84 g/mol. Its IUPAC name is decan-4-yl 4-chlorohexa-4,5-dienoate.
Molecular Properties
| Compound Name | decan-4-yl 4-chlorohexa-4,5-dienoate |
| PubChem CID | 170618796 |
| Molecular Formula | C16H27ClO2 |
| Molecular Weight | 286.84 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | decan-4-yl 4-chlorohexa-4,5-dienoate |
| SMILES | C=C=C(Cl)CCC(=O)OC(CCC)CCCCCC |
| InChI | InChI=1S/C16H27ClO2/c1-4-7-8-9-11-15(10-5-2)19-16(18)13-12-14(17)6-3/h15H,3-5,7-13H2,1-2H3 |
| InChIKey | WKZBTLDGEWNXRA-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 286.84 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze decan-4-yl 4-chlorohexa-4,5-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of decan-4-yl 4-chlorohexa-4,5-dienoate?
The IUPAC name of decan-4-yl 4-chlorohexa-4,5-dienoate (CID 170618796) is decan-4-yl 4-chlorohexa-4,5-dienoate.
What is the SMILES notation for decan-4-yl 4-chlorohexa-4,5-dienoate?
The canonical SMILES for decan-4-yl 4-chlorohexa-4,5-dienoate is C=C=C(Cl)CCC(=O)OC(CCC)CCCCCC.
What is the InChIKey of decan-4-yl 4-chlorohexa-4,5-dienoate?
The InChIKey is WKZBTLDGEWNXRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27ClO2/c1-4-7-8-9-11-15(10-5-2)19-16(18)13-12-14(17)6-3/h15H,3-5,7-13H2,1-2H3.
What are the key properties of decan-4-yl 4-chlorohexa-4,5-dienoate?
decan-4-yl 4-chlorohexa-4,5-dienoate has a molecular weight of 286.84 g/mol, XLogP of 5.36, 11 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for decan-4-yl 4-chlorohexa-4,5-dienoate is sourced from PubChem (CID 170618796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).