About 5-(cyclobutylmethyl)-2,2-dimethyl-1,3-dioxane
5-(cyclobutylmethyl)-2,2-dimethyl-1,3-dioxane (PubChem CID 170618817) has the molecular formula C11H20O2
and a molecular weight of 184.28 g/mol. Its IUPAC name is 5-(cyclobutylmethyl)-2,2-dimethyl-1,3-dioxane.
Molecular Properties
| Compound Name | 5-(cyclobutylmethyl)-2,2-dimethyl-1,3-dioxane |
| PubChem CID | 170618817 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | 5-(cyclobutylmethyl)-2,2-dimethyl-1,3-dioxane |
| SMILES | CC1(C)OCC(CC2CCC2)CO1 |
| InChI | InChI=1S/C11H20O2/c1-11(2)12-7-10(8-13-11)6-9-4-3-5-9/h9-10H,3-8H2,1-2H3 |
| InChIKey | BVIBSIILFJOMIT-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(cyclobutylmethyl)-2,2-dimethyl-1,3-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(cyclobutylmethyl)-2,2-dimethyl-1,3-dioxane?
The IUPAC name of 5-(cyclobutylmethyl)-2,2-dimethyl-1,3-dioxane (CID 170618817) is 5-(cyclobutylmethyl)-2,2-dimethyl-1,3-dioxane.
What is the SMILES notation for 5-(cyclobutylmethyl)-2,2-dimethyl-1,3-dioxane?
The canonical SMILES for 5-(cyclobutylmethyl)-2,2-dimethyl-1,3-dioxane is CC1(C)OCC(CC2CCC2)CO1.
What is the InChIKey of 5-(cyclobutylmethyl)-2,2-dimethyl-1,3-dioxane?
The InChIKey is BVIBSIILFJOMIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O2/c1-11(2)12-7-10(8-13-11)6-9-4-3-5-9/h9-10H,3-8H2,1-2H3.
What are the key properties of 5-(cyclobutylmethyl)-2,2-dimethyl-1,3-dioxane?
5-(cyclobutylmethyl)-2,2-dimethyl-1,3-dioxane has a molecular weight of 184.28 g/mol, XLogP of 2.58, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(cyclobutylmethyl)-2,2-dimethyl-1,3-dioxane is sourced from PubChem (CID 170618817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).