About 6-[(4,5-dibromo-3-nitropyrazol-1-yl)methyl]pyridine-3-carbonitrile
6-[(4,5-dibromo-3-nitropyrazol-1-yl)methyl]pyridine-3-carbonitrile (PubChem CID 170619197) has the molecular formula C10H5Br2N5O2
and a molecular weight of 386.99 g/mol. Its IUPAC name is 6-[(4,5-dibromo-3-nitropyrazol-1-yl)methyl]pyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 6-[(4,5-dibromo-3-nitropyrazol-1-yl)methyl]pyridine-3-carbonitrile |
| PubChem CID | 170619197 |
| Molecular Formula | C10H5Br2N5O2 |
| Molecular Weight | 386.99 g/mol |
| Exact Mass | 384.88 |
| IUPAC Name | 6-[(4,5-dibromo-3-nitropyrazol-1-yl)methyl]pyridine-3-carbonitrile |
| SMILES | N#Cc1ccc(Cn2nc([N+](=O)[O-])c(Br)c2Br)nc1 |
| InChI | InChI=1S/C10H5Br2N5O2/c11-8-9(12)16(15-10(8)17(18)19)5-7-2-1-6(3-13)4-14-7/h1-2,4H,5H2 |
| InChIKey | PEGLIYOABUISID-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 97.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.99 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-[(4,5-dibromo-3-nitropyrazol-1-yl)methyl]pyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(4,5-dibromo-3-nitropyrazol-1-yl)methyl]pyridine-3-carbonitrile?
The IUPAC name of 6-[(4,5-dibromo-3-nitropyrazol-1-yl)methyl]pyridine-3-carbonitrile (CID 170619197) is 6-[(4,5-dibromo-3-nitropyrazol-1-yl)methyl]pyridine-3-carbonitrile.
What is the SMILES notation for 6-[(4,5-dibromo-3-nitropyrazol-1-yl)methyl]pyridine-3-carbonitrile?
The canonical SMILES for 6-[(4,5-dibromo-3-nitropyrazol-1-yl)methyl]pyridine-3-carbonitrile is N#Cc1ccc(Cn2nc([N+](=O)[O-])c(Br)c2Br)nc1.
What is the InChIKey of 6-[(4,5-dibromo-3-nitropyrazol-1-yl)methyl]pyridine-3-carbonitrile?
The InChIKey is PEGLIYOABUISID-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5Br2N5O2/c11-8-9(12)16(15-10(8)17(18)19)5-7-2-1-6(3-13)4-14-7/h1-2,4H,5H2.
What are the key properties of 6-[(4,5-dibromo-3-nitropyrazol-1-yl)methyl]pyridine-3-carbonitrile?
6-[(4,5-dibromo-3-nitropyrazol-1-yl)methyl]pyridine-3-carbonitrile has a molecular weight of 386.99 g/mol, XLogP of 2.63, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(4,5-dibromo-3-nitropyrazol-1-yl)methyl]pyridine-3-carbonitrile is sourced from PubChem (CID 170619197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).