About (3Z)-4-(1-amino-2,2-difluoroethyl)-5-fluoro-2-methylidenehexa-3,5-dienenitrile
(3Z)-4-(1-amino-2,2-difluoroethyl)-5-fluoro-2-methylidenehexa-3,5-dienenitrile (PubChem CID 170619247) has the molecular formula C9H9F3N2
and a molecular weight of 202.18 g/mol. Its IUPAC name is (3Z)-4-(1-amino-2,2-difluoroethyl)-5-fluoro-2-methylidenehexa-3,5-dienenitrile.
Molecular Properties
| Compound Name | (3Z)-4-(1-amino-2,2-difluoroethyl)-5-fluoro-2-methylidenehexa-3,5-dienenitrile |
| PubChem CID | 170619247 |
| Molecular Formula | C9H9F3N2 |
| Molecular Weight | 202.18 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | (3Z)-4-(1-amino-2,2-difluoroethyl)-5-fluoro-2-methylidenehexa-3,5-dienenitrile |
| SMILES | C=C(C#N)/C=C(\C(=C)F)C(N)C(F)F |
| InChI | InChI=1S/C9H9F3N2/c1-5(4-13)3-7(6(2)10)8(14)9(11)12/h3,8-9H,1-2,14H2/b7-3+ |
| InChIKey | NMRHCJQQANXBHO-XVNBXDOJSA-N |
| XLogP | 2.07 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.18 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-4-(1-amino-2,2-difluoroethyl)-5-fluoro-2-methylidenehexa-3,5-dienenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-4-(1-amino-2,2-difluoroethyl)-5-fluoro-2-methylidenehexa-3,5-dienenitrile?
The IUPAC name of (3Z)-4-(1-amino-2,2-difluoroethyl)-5-fluoro-2-methylidenehexa-3,5-dienenitrile (CID 170619247) is (3Z)-4-(1-amino-2,2-difluoroethyl)-5-fluoro-2-methylidenehexa-3,5-dienenitrile.
What is the SMILES notation for (3Z)-4-(1-amino-2,2-difluoroethyl)-5-fluoro-2-methylidenehexa-3,5-dienenitrile?
The canonical SMILES for (3Z)-4-(1-amino-2,2-difluoroethyl)-5-fluoro-2-methylidenehexa-3,5-dienenitrile is C=C(C#N)/C=C(\C(=C)F)C(N)C(F)F.
What is the InChIKey of (3Z)-4-(1-amino-2,2-difluoroethyl)-5-fluoro-2-methylidenehexa-3,5-dienenitrile?
The InChIKey is NMRHCJQQANXBHO-XVNBXDOJSA-N. The full InChI is InChI=1S/C9H9F3N2/c1-5(4-13)3-7(6(2)10)8(14)9(11)12/h3,8-9H,1-2,14H2/b7-3+.
What are the key properties of (3Z)-4-(1-amino-2,2-difluoroethyl)-5-fluoro-2-methylidenehexa-3,5-dienenitrile?
(3Z)-4-(1-amino-2,2-difluoroethyl)-5-fluoro-2-methylidenehexa-3,5-dienenitrile has a molecular weight of 202.18 g/mol, XLogP of 2.07, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-4-(1-amino-2,2-difluoroethyl)-5-fluoro-2-methylidenehexa-3,5-dienenitrile is sourced from PubChem (CID 170619247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).