C15H23F2NS — CID 170619298
1-cyclopropyl-1-(3,5-difluorophenyl)-N-methylmethanamine;2-methylpropane-2-thiol (PubChem CID 170619298) has the molecular formula C15H23F2NS and a molecular weight of 287.42 g/mol. Its IUPAC name is 1-cyclopropyl-1-(3,5-difluorophenyl)-N-methylmethanamine;2-methylpropane-2-thiol.
| Compound Name | 1-cyclopropyl-1-(3,5-difluorophenyl)-N-methylmethanamine;2-methylpropane-2-thiol |
|---|---|
| PubChem CID | 170619298 |
| Molecular Formula | C15H23F2NS |
| Molecular Weight | 287.42 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 1-cyclopropyl-1-(3,5-difluorophenyl)-N-methylmethanamine;2-methylpropane-2-thiol |
| SMILES | CC(C)(C)S.CNC(c1cc(F)cc(F)c1)C1CC1 |
| InChI | InChI=1S/C11H13F2N.C4H10S/c1-14-11(7-2-3-7)8-4-9(12)6-10(13)5-8;1-4(2,3)5/h4-7,11,14H,2-3H2,1H3;5H,1-3H3 |
| InChIKey | PQWLAJCGRIMCCE-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.42 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|