About N-[(R)-(3,5-difluorophenyl)-hydroxymethyl]-2-methylpropane-2-sulfinamide
N-[(R)-(3,5-difluorophenyl)-hydroxymethyl]-2-methylpropane-2-sulfinamide (PubChem CID 170619325) has the molecular formula C11H15F2NO2S
and a molecular weight of 263.31 g/mol. Its IUPAC name is N-[(R)-(3,5-difluorophenyl)-hydroxymethyl]-2-methylpropane-2-sulfinamide.
Molecular Properties
| Compound Name | N-[(R)-(3,5-difluorophenyl)-hydroxymethyl]-2-methylpropane-2-sulfinamide |
| PubChem CID | 170619325 |
| Molecular Formula | C11H15F2NO2S |
| Molecular Weight | 263.31 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | N-[(R)-(3,5-difluorophenyl)-hydroxymethyl]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)S(=O)N[C@H](O)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C11H15F2NO2S/c1-11(2,3)17(16)14-10(15)7-4-8(12)6-9(13)5-7/h4-6,10,14-15H,1-3H3/t10-,17?/m1/s1 |
| InChIKey | GHIUWQAEWAGPBX-YQDUUYOCSA-N |
| XLogP | 2.01 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.31 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-[(R)-(3,5-difluorophenyl)-hydroxymethyl]-2-methylpropane-2-sulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(R)-(3,5-difluorophenyl)-hydroxymethyl]-2-methylpropane-2-sulfinamide?
The IUPAC name of N-[(R)-(3,5-difluorophenyl)-hydroxymethyl]-2-methylpropane-2-sulfinamide (CID 170619325) is N-[(R)-(3,5-difluorophenyl)-hydroxymethyl]-2-methylpropane-2-sulfinamide.
What is the SMILES notation for N-[(R)-(3,5-difluorophenyl)-hydroxymethyl]-2-methylpropane-2-sulfinamide?
The canonical SMILES for N-[(R)-(3,5-difluorophenyl)-hydroxymethyl]-2-methylpropane-2-sulfinamide is CC(C)(C)S(=O)N[C@H](O)c1cc(F)cc(F)c1.
What is the InChIKey of N-[(R)-(3,5-difluorophenyl)-hydroxymethyl]-2-methylpropane-2-sulfinamide?
The InChIKey is GHIUWQAEWAGPBX-YQDUUYOCSA-N. The full InChI is InChI=1S/C11H15F2NO2S/c1-11(2,3)17(16)14-10(15)7-4-8(12)6-9(13)5-7/h4-6,10,14-15H,1-3H3/t10-,17?/m1/s1.
What are the key properties of N-[(R)-(3,5-difluorophenyl)-hydroxymethyl]-2-methylpropane-2-sulfinamide?
N-[(R)-(3,5-difluorophenyl)-hydroxymethyl]-2-methylpropane-2-sulfinamide has a molecular weight of 263.31 g/mol, XLogP of 2.01, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(R)-(3,5-difluorophenyl)-hydroxymethyl]-2-methylpropane-2-sulfinamide is sourced from PubChem (CID 170619325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).