About [3,5-bis(trifluoromethyl)cyclohexa-2,4-dien-1-yl]urea
[3,5-bis(trifluoromethyl)cyclohexa-2,4-dien-1-yl]urea (PubChem CID 170620068) has the molecular formula C9H8F6N2O
and a molecular weight of 274.16 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)cyclohexa-2,4-dien-1-yl]urea.
Molecular Properties
| Compound Name | [3,5-bis(trifluoromethyl)cyclohexa-2,4-dien-1-yl]urea |
| PubChem CID | 170620068 |
| Molecular Formula | C9H8F6N2O |
| Molecular Weight | 274.16 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | [3,5-bis(trifluoromethyl)cyclohexa-2,4-dien-1-yl]urea |
| SMILES | NC(=O)NC1C=C(C(F)(F)F)C=C(C(F)(F)F)C1 |
| InChI | InChI=1S/C9H8F6N2O/c10-8(11,12)4-1-5(9(13,14)15)3-6(2-4)17-7(16)18/h1-2,6H,3H2,(H3,16,17,18) |
| InChIKey | ZZCZJCTVSOWOPI-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.16 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze [3,5-bis(trifluoromethyl)cyclohexa-2,4-dien-1-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3,5-bis(trifluoromethyl)cyclohexa-2,4-dien-1-yl]urea?
The IUPAC name of [3,5-bis(trifluoromethyl)cyclohexa-2,4-dien-1-yl]urea (CID 170620068) is [3,5-bis(trifluoromethyl)cyclohexa-2,4-dien-1-yl]urea.
What is the SMILES notation for [3,5-bis(trifluoromethyl)cyclohexa-2,4-dien-1-yl]urea?
The canonical SMILES for [3,5-bis(trifluoromethyl)cyclohexa-2,4-dien-1-yl]urea is NC(=O)NC1C=C(C(F)(F)F)C=C(C(F)(F)F)C1.
What is the InChIKey of [3,5-bis(trifluoromethyl)cyclohexa-2,4-dien-1-yl]urea?
The InChIKey is ZZCZJCTVSOWOPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8F6N2O/c10-8(11,12)4-1-5(9(13,14)15)3-6(2-4)17-7(16)18/h1-2,6H,3H2,(H3,16,17,18).
What are the key properties of [3,5-bis(trifluoromethyl)cyclohexa-2,4-dien-1-yl]urea?
[3,5-bis(trifluoromethyl)cyclohexa-2,4-dien-1-yl]urea has a molecular weight of 274.16 g/mol, XLogP of 2.40, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [3,5-bis(trifluoromethyl)cyclohexa-2,4-dien-1-yl]urea is sourced from PubChem (CID 170620068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).