C30H33N5O4S — CID 170620525
(E)-2-[3-[[2,6-dimethoxy-4-(1,4,5-trimethyl-6-oxo-3-pyridinyl)phenyl]methyl]-3,8-diazabicyclo[3.2.1]octane-8-carbonyl]-3-(1,3-thiazol-2-yl)prop-2-enenitrile (PubChem CID 170620525) has the molecular formula C30H33N5O4S and a molecular weight of 559.69 g/mol. Its IUPAC name is (E)-2-[3-[[2,6-dimethoxy-4-(1,4,5-trimethyl-6-oxo-3-pyridinyl)phenyl]methyl]-3,8-diazabicyclo[3.2.1]octane-8-carbonyl]-3-(1,3-thiazol-2-yl)prop-2-enenitrile.
| Compound Name | (E)-2-[3-[[2,6-dimethoxy-4-(1,4,5-trimethyl-6-oxo-3-pyridinyl)phenyl]methyl]-3,8-diazabicyclo[3.2.1]octane-8-carbonyl]-3-(1,3-thiazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 170620525 |
| Molecular Formula | C30H33N5O4S |
| Molecular Weight | 559.69 g/mol |
| Exact Mass | 559.23 |
| IUPAC Name | (E)-2-[3-[[2,6-dimethoxy-4-(1,4,5-trimethyl-6-oxo-3-pyridinyl)phenyl]methyl]-3,8-diazabicyclo[3.2.1]octane-8-carbonyl]-3-(1,3-thiazol-2-yl)prop-2-enenitrile |
| SMILES | COc1cc(-c2cn(C)c(=O)c(C)c2C)cc(OC)c1CN1CC2CCC(C1)N2C(=O)/C(C#N)=C/c1nccs1 |
| InChI | InChI=1S/C30H33N5O4S/c1-18-19(2)29(36)33(3)16-24(18)20-10-26(38-4)25(27(11-20)39-5)17-34-14-22-6-7-23(15-34)35(22)30(37)21(13-31)12-28-32-8-9-40-28/h8-12,16,22-23H,6-7,14-15,17H2,1-5H3/b21-12+ |
| InChIKey | YQRVPVSLURSFFD-CIAFOILYSA-N |
| XLogP | 3.93 |
| TPSA | 100.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.69 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|