C21H41NO3 — CID 170620634
ethane;5-propan-2-yl-1-[(E)-2,4,4-trimethylpent-2-enoyl]piperidine-3-carboxylic acid (PubChem CID 170620634) has the molecular formula C21H41NO3 and a molecular weight of 355.56 g/mol. Its IUPAC name is ethane;5-propan-2-yl-1-[(E)-2,4,4-trimethylpent-2-enoyl]piperidine-3-carboxylic acid.
| Compound Name | ethane;5-propan-2-yl-1-[(E)-2,4,4-trimethylpent-2-enoyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 170620634 |
| Molecular Formula | C21H41NO3 |
| Molecular Weight | 355.56 g/mol |
| Exact Mass | 355.31 |
| IUPAC Name | ethane;5-propan-2-yl-1-[(E)-2,4,4-trimethylpent-2-enoyl]piperidine-3-carboxylic acid |
| SMILES | C/C(=C\C(C)(C)C)C(=O)N1CC(C(=O)O)CC(C(C)C)C1.CC.CC |
| InChI | InChI=1S/C17H29NO3.2C2H6/c1-11(2)13-7-14(16(20)21)10-18(9-13)15(19)12(3)8-17(4,5)6;2*1-2/h8,11,13-14H,7,9-10H2,1-6H3,(H,20,21);2*1-2H3/b12-8+;; |
| InChIKey | DTBREHTURHOQOP-BPWZRWDXSA-N |
| XLogP | 5.24 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.56 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|