C23H29N3O3 — CID 170620854
1-[(2E,5Z)-2-cyano-4-iminoocta-2,5-dienoyl]-5-phenylpiperidine-3-carboxylic acid;ethane (PubChem CID 170620854) has the molecular formula C23H29N3O3 and a molecular weight of 395.50 g/mol. Its IUPAC name is 1-[(2E,5Z)-2-cyano-4-iminoocta-2,5-dienoyl]-5-phenylpiperidine-3-carboxylic acid;ethane.
| Compound Name | 1-[(2E,5Z)-2-cyano-4-iminoocta-2,5-dienoyl]-5-phenylpiperidine-3-carboxylic acid;ethane |
|---|---|
| PubChem CID | 170620854 |
| Molecular Formula | C23H29N3O3 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | 1-[(2E,5Z)-2-cyano-4-iminoocta-2,5-dienoyl]-5-phenylpiperidine-3-carboxylic acid;ethane |
| SMILES | CC.[H]/N=C(\C=C/CC)/C=C(\C#N)C(=O)N1CC(C(=O)O)CC(c2ccccc2)C1 |
| InChI | InChI=1S/C21H23N3O3.C2H6/c1-2-3-9-19(23)11-16(12-22)20(25)24-13-17(10-18(14-24)21(26)27)15-7-5-4-6-8-15;1-2/h3-9,11,17-18,23H,2,10,13-14H2,1H3,(H,26,27);1-2H3/b9-3-,16-11+,23-19+; |
| InChIKey | KVOWVXVXMJYUMD-JZPQCZRHSA-N |
| XLogP | 4.17 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|