C28H48N4O8 — CID 170621029
1-[(E)-2-cyano-4,4-dimethylpent-2-enoyl]-N-[2-[2-[2-[2-[2-(2-formamidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]-5-methylpiperidine-3-carboxamide (PubChem CID 170621029) has the molecular formula C28H48N4O8 and a molecular weight of 568.71 g/mol. Its IUPAC name is 1-[(E)-2-cyano-4,4-dimethylpent-2-enoyl]-N-[2-[2-[2-[2-[2-(2-formamidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]-5-methylpiperidine-3-carboxamide.
| Compound Name | 1-[(E)-2-cyano-4,4-dimethylpent-2-enoyl]-N-[2-[2-[2-[2-[2-(2-formamidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]-5-methylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 170621029 |
| Molecular Formula | C28H48N4O8 |
| Molecular Weight | 568.71 g/mol |
| Exact Mass | 568.35 |
| IUPAC Name | 1-[(E)-2-cyano-4,4-dimethylpent-2-enoyl]-N-[2-[2-[2-[2-[2-(2-formamidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]-5-methylpiperidine-3-carboxamide |
| SMILES | CC1CC(C(=O)NCCOCCOCCOCCOCCOCCNC=O)CN(C(=O)/C(C#N)=C/C(C)(C)C)C1 |
| InChI | InChI=1S/C28H48N4O8/c1-23-17-24(21-32(20-23)27(35)25(19-29)18-28(2,3)4)26(34)31-6-8-37-10-12-39-14-16-40-15-13-38-11-9-36-7-5-30-22-33/h18,22-24H,5-17,20-21H2,1-4H3,(H,30,33)(H,31,34)/b25-18+ |
| InChIKey | XLTYBQWHTYXCJP-XIEYBQDHSA-N |
| XLogP | 0.91 |
| TPSA | 148.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.71 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|