C27H33N5O3S — CID 170621081
N-(5-acetamidopentyl)-1-[(E)-2-cyano-3-(1,3-thiazol-2-yl)prop-2-enoyl]-5-(3-methylphenyl)piperidine-3-carboxamide (PubChem CID 170621081) has the molecular formula C27H33N5O3S and a molecular weight of 507.66 g/mol. Its IUPAC name is N-(5-acetamidopentyl)-1-[(E)-2-cyano-3-(1,3-thiazol-2-yl)prop-2-enoyl]-5-(3-methylphenyl)piperidine-3-carboxamide.
| Compound Name | N-(5-acetamidopentyl)-1-[(E)-2-cyano-3-(1,3-thiazol-2-yl)prop-2-enoyl]-5-(3-methylphenyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 170621081 |
| Molecular Formula | C27H33N5O3S |
| Molecular Weight | 507.66 g/mol |
| Exact Mass | 507.23 |
| IUPAC Name | N-(5-acetamidopentyl)-1-[(E)-2-cyano-3-(1,3-thiazol-2-yl)prop-2-enoyl]-5-(3-methylphenyl)piperidine-3-carboxamide |
| SMILES | CC(=O)NCCCCCNC(=O)C1CC(c2cccc(C)c2)CN(C(=O)/C(C#N)=C/c2nccs2)C1 |
| InChI | InChI=1S/C27H33N5O3S/c1-19-7-6-8-21(13-19)23-14-24(26(34)31-10-5-3-4-9-29-20(2)33)18-32(17-23)27(35)22(16-28)15-25-30-11-12-36-25/h6-8,11-13,15,23-24H,3-5,9-10,14,17-18H2,1-2H3,(H,29,33)(H,31,34)/b22-15+ |
| InChIKey | XOIHLZLOIKGTLH-PXLXIMEGSA-N |
| XLogP | 3.41 |
| TPSA | 115.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.66 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|