About 9,9-bis(4-iodo-3,5-dimethylphenyl)fluorene
9,9-bis(4-iodo-3,5-dimethylphenyl)fluorene (PubChem CID 170621532) has the molecular formula C29H24I2
and a molecular weight of 626.32 g/mol. Its IUPAC name is 9,9-bis(4-iodo-3,5-dimethylphenyl)fluorene.
Molecular Properties
| Compound Name | 9,9-bis(4-iodo-3,5-dimethylphenyl)fluorene |
| PubChem CID | 170621532 |
| Molecular Formula | C29H24I2 |
| Molecular Weight | 626.32 g/mol |
| Exact Mass | 626.00 |
| IUPAC Name | 9,9-bis(4-iodo-3,5-dimethylphenyl)fluorene |
| SMILES | Cc1cc(C2(c3cc(C)c(I)c(C)c3)c3ccccc3-c3ccccc32)cc(C)c1I |
| InChI | InChI=1S/C29H24I2/c1-17-13-21(14-18(2)27(17)30)29(22-15-19(3)28(31)20(4)16-22)25-11-7-5-9-23(25)24-10-6-8-12-26(24)29/h5-16H,1-4H3 |
| InChIKey | GTTGJZSUOUZWFR-UHFFFAOYSA-N |
| XLogP | 8.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 626.32 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 9,9-bis(4-iodo-3,5-dimethylphenyl)fluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9,9-bis(4-iodo-3,5-dimethylphenyl)fluorene?
The IUPAC name of 9,9-bis(4-iodo-3,5-dimethylphenyl)fluorene (CID 170621532) is 9,9-bis(4-iodo-3,5-dimethylphenyl)fluorene.
What is the SMILES notation for 9,9-bis(4-iodo-3,5-dimethylphenyl)fluorene?
The canonical SMILES for 9,9-bis(4-iodo-3,5-dimethylphenyl)fluorene is Cc1cc(C2(c3cc(C)c(I)c(C)c3)c3ccccc3-c3ccccc32)cc(C)c1I.
What is the InChIKey of 9,9-bis(4-iodo-3,5-dimethylphenyl)fluorene?
The InChIKey is GTTGJZSUOUZWFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H24I2/c1-17-13-21(14-18(2)27(17)30)29(22-15-19(3)28(31)20(4)16-22)25-11-7-5-9-23(25)24-10-6-8-12-26(24)29/h5-16H,1-4H3.
What are the key properties of 9,9-bis(4-iodo-3,5-dimethylphenyl)fluorene?
9,9-bis(4-iodo-3,5-dimethylphenyl)fluorene has a molecular weight of 626.32 g/mol, XLogP of 8.49, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 9,9-bis(4-iodo-3,5-dimethylphenyl)fluorene is sourced from PubChem (CID 170621532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).