C11H19NO4 — CID 170621954
(4Z)-2,2-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonylimino]butanoic acid (PubChem CID 170621954) has the molecular formula C11H19NO4 and a molecular weight of 229.28 g/mol. Its IUPAC name is (4Z)-2,2-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonylimino]butanoic acid.
| Compound Name | (4Z)-2,2-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonylimino]butanoic acid |
|---|---|
| PubChem CID | 170621954 |
| Molecular Formula | C11H19NO4 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | (4Z)-2,2-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonylimino]butanoic acid |
| SMILES | CC(C)(C)OC(=O)/N=C\CC(C)(C)C(=O)O |
| InChI | InChI=1S/C11H19NO4/c1-10(2,3)16-9(15)12-7-6-11(4,5)8(13)14/h7H,6H2,1-5H3,(H,13,14)/b12-7- |
| InChIKey | ZAOQJBBPYNERDN-GHXNOFRVSA-N |
| XLogP | 2.49 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|