C10H6F5N3O — CID 170622695
7-amino-4-(1,1,2,2,2-pentafluoroethyl)-1H-1,8-naphthyridin-2-one (PubChem CID 170622695) has the molecular formula C10H6F5N3O and a molecular weight of 279.17 g/mol. Its IUPAC name is 7-amino-4-(1,1,2,2,2-pentafluoroethyl)-1H-1,8-naphthyridin-2-one.
| Compound Name | 7-amino-4-(1,1,2,2,2-pentafluoroethyl)-1H-1,8-naphthyridin-2-one |
|---|---|
| PubChem CID | 170622695 |
| Molecular Formula | C10H6F5N3O |
| Molecular Weight | 279.17 g/mol |
| Exact Mass | 279.04 |
| IUPAC Name | 7-amino-4-(1,1,2,2,2-pentafluoroethyl)-1H-1,8-naphthyridin-2-one |
| SMILES | Nc1ccc2c(C(F)(F)C(F)(F)F)cc(=O)[nH]c2n1 |
| InChI | InChI=1S/C10H6F5N3O/c11-9(12,10(13,14)15)5-3-7(19)18-8-4(5)1-2-6(16)17-8/h1-3H,(H3,16,17,18,19) |
| InChIKey | CWRHNKUGUIQAOJ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.17 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|