C14H7F8N5O — CID 170622715
2-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazolo[1,5-h][1,7]naphthyridine-9-carbohydrazide (PubChem CID 170622715) has the molecular formula C14H7F8N5O and a molecular weight of 413.23 g/mol. Its IUPAC name is 2-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazolo[1,5-h][1,7]naphthyridine-9-carbohydrazide.
| Compound Name | 2-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazolo[1,5-h][1,7]naphthyridine-9-carbohydrazide |
|---|---|
| PubChem CID | 170622715 |
| Molecular Formula | C14H7F8N5O |
| Molecular Weight | 413.23 g/mol |
| Exact Mass | 413.05 |
| IUPAC Name | 2-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazolo[1,5-h][1,7]naphthyridine-9-carbohydrazide |
| SMILES | NNC(=O)c1cc2c3nc(C(F)(F)C(F)(F)F)cc(C(F)(F)F)c3ccn2n1 |
| InChI | InChI=1S/C14H7F8N5O/c15-12(16,14(20,21)22)9-3-6(13(17,18)19)5-1-2-27-8(10(5)24-9)4-7(26-27)11(28)25-23/h1-4H,23H2,(H,25,28) |
| InChIKey | ZSKLNVIZLNZXLF-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 85.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.23 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|