About 1-butylsulfonyl-N-(1,3-thiazol-2-ylmethyl)piperidin-4-amine
1-butylsulfonyl-N-(1,3-thiazol-2-ylmethyl)piperidin-4-amine (PubChem CID 170623111) has the molecular formula C13H23N3O2S2
and a molecular weight of 317.48 g/mol. Its IUPAC name is 1-butylsulfonyl-N-(1,3-thiazol-2-ylmethyl)piperidin-4-amine.
Molecular Properties
| Compound Name | 1-butylsulfonyl-N-(1,3-thiazol-2-ylmethyl)piperidin-4-amine |
| PubChem CID | 170623111 |
| Molecular Formula | C13H23N3O2S2 |
| Molecular Weight | 317.48 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 1-butylsulfonyl-N-(1,3-thiazol-2-ylmethyl)piperidin-4-amine |
| SMILES | CCCCS(=O)(=O)N1CCC(NCc2nccs2)CC1 |
| InChI | InChI=1S/C13H23N3O2S2/c1-2-3-10-20(17,18)16-7-4-12(5-8-16)15-11-13-14-6-9-19-13/h6,9,12,15H,2-5,7-8,10-11H2,1H3 |
| InChIKey | TYKUVDOSVBTKRP-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.48 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-butylsulfonyl-N-(1,3-thiazol-2-ylmethyl)piperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butylsulfonyl-N-(1,3-thiazol-2-ylmethyl)piperidin-4-amine?
The IUPAC name of 1-butylsulfonyl-N-(1,3-thiazol-2-ylmethyl)piperidin-4-amine (CID 170623111) is 1-butylsulfonyl-N-(1,3-thiazol-2-ylmethyl)piperidin-4-amine.
What is the SMILES notation for 1-butylsulfonyl-N-(1,3-thiazol-2-ylmethyl)piperidin-4-amine?
The canonical SMILES for 1-butylsulfonyl-N-(1,3-thiazol-2-ylmethyl)piperidin-4-amine is CCCCS(=O)(=O)N1CCC(NCc2nccs2)CC1.
What is the InChIKey of 1-butylsulfonyl-N-(1,3-thiazol-2-ylmethyl)piperidin-4-amine?
The InChIKey is TYKUVDOSVBTKRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23N3O2S2/c1-2-3-10-20(17,18)16-7-4-12(5-8-16)15-11-13-14-6-9-19-13/h6,9,12,15H,2-5,7-8,10-11H2,1H3.
What are the key properties of 1-butylsulfonyl-N-(1,3-thiazol-2-ylmethyl)piperidin-4-amine?
1-butylsulfonyl-N-(1,3-thiazol-2-ylmethyl)piperidin-4-amine has a molecular weight of 317.48 g/mol, XLogP of 1.83, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butylsulfonyl-N-(1,3-thiazol-2-ylmethyl)piperidin-4-amine is sourced from PubChem (CID 170623111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).