C20H27N5O5S — CID 170623551
[(1R,3S)-3-[3-[(3-methyl-1,1-dioxo-2,3-dihydro-4,1λ6,2-benzoxathiazin-8-yl)amino]-1H-pyrazol-5-yl]cyclopentyl] N-propan-2-ylcarbamate (PubChem CID 170623551) has the molecular formula C20H27N5O5S and a molecular weight of 449.53 g/mol. Its IUPAC name is [(1R,3S)-3-[3-[(3-methyl-1,1-dioxo-2,3-dihydro-4,1λ6,2-benzoxathiazin-8-yl)amino]-1H-pyrazol-5-yl]cyclopentyl] N-propan-2-ylcarbamate.
| Compound Name | [(1R,3S)-3-[3-[(3-methyl-1,1-dioxo-2,3-dihydro-4,1λ6,2-benzoxathiazin-8-yl)amino]-1H-pyrazol-5-yl]cyclopentyl] N-propan-2-ylcarbamate |
|---|---|
| PubChem CID | 170623551 |
| Molecular Formula | C20H27N5O5S |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | [(1R,3S)-3-[3-[(3-methyl-1,1-dioxo-2,3-dihydro-4,1λ6,2-benzoxathiazin-8-yl)amino]-1H-pyrazol-5-yl]cyclopentyl] N-propan-2-ylcarbamate |
| SMILES | CC(C)NC(=O)O[C@@H]1CC[C@H](c2cc(Nc3cccc4c3S(=O)(=O)NC(C)O4)n[nH]2)C1 |
| InChI | InChI=1S/C20H27N5O5S/c1-11(2)21-20(26)30-14-8-7-13(9-14)16-10-18(24-23-16)22-15-5-4-6-17-19(15)31(27,28)25-12(3)29-17/h4-6,10-14,25H,7-9H2,1-3H3,(H,21,26)(H2,22,23,24)/t12?,13-,14+/m0/s1 |
| InChIKey | CAQITAIBNKVMKP-KFTPUPIBSA-N |
| XLogP | 2.94 |
| TPSA | 134.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |