C19H25N5O — CID 170624792
2-[(1Z)-1,4,4-triamino-3-(1-cyclohexylpyrazol-4-yl)buta-1,3-dienyl]phenol (PubChem CID 170624792) has the molecular formula C19H25N5O and a molecular weight of 339.44 g/mol. Its IUPAC name is 2-[(1Z)-1,4,4-triamino-3-(1-cyclohexylpyrazol-4-yl)buta-1,3-dienyl]phenol.
| Compound Name | 2-[(1Z)-1,4,4-triamino-3-(1-cyclohexylpyrazol-4-yl)buta-1,3-dienyl]phenol |
|---|---|
| PubChem CID | 170624792 |
| Molecular Formula | C19H25N5O |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.21 |
| IUPAC Name | 2-[(1Z)-1,4,4-triamino-3-(1-cyclohexylpyrazol-4-yl)buta-1,3-dienyl]phenol |
| SMILES | NC(N)=C(/C=C(\N)c1ccccc1O)c1cnn(C2CCCCC2)c1 |
| InChI | InChI=1S/C19H25N5O/c20-17(15-8-4-5-9-18(15)25)10-16(19(21)22)13-11-23-24(12-13)14-6-2-1-3-7-14/h4-5,8-12,14,25H,1-3,6-7,20-22H2/b17-10- |
| InChIKey | FLGCPTWRYJRXME-YVLHZVERSA-N |
| XLogP | 2.68 |
| TPSA | 116.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|