C18H22ClN7O — CID 170624997
(1S,5R)-3-[3-amino-6-(3-chloro-2-hydroxyphenyl)pyridazin-4-yl]-N'-methyl-3,8-diazabicyclo[3.2.1]octane-8-carboximidamide (PubChem CID 170624997) has the molecular formula C18H22ClN7O and a molecular weight of 387.88 g/mol. Its IUPAC name is (1S,5R)-3-[3-amino-6-(3-chloro-2-hydroxyphenyl)pyridazin-4-yl]-N'-methyl-3,8-diazabicyclo[3.2.1]octane-8-carboximidamide.
| Compound Name | (1S,5R)-3-[3-amino-6-(3-chloro-2-hydroxyphenyl)pyridazin-4-yl]-N'-methyl-3,8-diazabicyclo[3.2.1]octane-8-carboximidamide |
|---|---|
| PubChem CID | 170624997 |
| Molecular Formula | C18H22ClN7O |
| Molecular Weight | 387.88 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | (1S,5R)-3-[3-amino-6-(3-chloro-2-hydroxyphenyl)pyridazin-4-yl]-N'-methyl-3,8-diazabicyclo[3.2.1]octane-8-carboximidamide |
| SMILES | C/N=C(\N)N1[C@@H]2CC[C@H]1CN(c1cc(-c3cccc(Cl)c3O)nnc1N)C2 |
| InChI | InChI=1S/C18H22ClN7O/c1-22-18(21)26-10-5-6-11(26)9-25(8-10)15-7-14(23-24-17(15)20)12-3-2-4-13(19)16(12)27/h2-4,7,10-11,27H,5-6,8-9H2,1H3,(H2,20,24)(H2,21,22)/t10-,11+ |
| InChIKey | BDEONNSXPHYZCL-PHIMTYICSA-N |
| XLogP | 1.68 |
| TPSA | 116.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.88 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|