C15H25NO2 — CID 170626439
N-[2-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]oxypropyl]-N-methyloxolan-3-amine (PubChem CID 170626439) has the molecular formula C15H25NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is N-[2-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]oxypropyl]-N-methyloxolan-3-amine.
| Compound Name | N-[2-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]oxypropyl]-N-methyloxolan-3-amine |
|---|---|
| PubChem CID | 170626439 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | N-[2-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]oxypropyl]-N-methyloxolan-3-amine |
| SMILES | C=C(/C=C\C=C/C)OC(C)CN(C)C1CCOC1 |
| InChI | InChI=1S/C15H25NO2/c1-5-6-7-8-13(2)18-14(3)11-16(4)15-9-10-17-12-15/h5-8,14-15H,2,9-12H2,1,3-4H3/b6-5-,8-7- |
| InChIKey | HUNJZYHUWFZMIZ-ISTTXYCBSA-N |
| XLogP | 2.76 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|