C10H11ClN4O — CID 170626595
4-(2-chloro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)morpholine (PubChem CID 170626595) has the molecular formula C10H11ClN4O and a molecular weight of 238.68 g/mol. Its IUPAC name is 4-(2-chloro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)morpholine.
| Compound Name | 4-(2-chloro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)morpholine |
|---|---|
| PubChem CID | 170626595 |
| Molecular Formula | C10H11ClN4O |
| Molecular Weight | 238.68 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | 4-(2-chloro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)morpholine |
| SMILES | Clc1nc2ccc(N3CCOCC3)cn2n1 |
| InChI | InChI=1S/C10H11ClN4O/c11-10-12-9-2-1-8(7-15(9)13-10)14-3-5-16-6-4-14/h1-2,7H,3-6H2 |
| InChIKey | MGFOXQHBIREJQZ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 42.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.68 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |