C22H21N5O2 — CID 170627442
1-[3-[4-[2-[6-amino-1-(methylamino)-2,7-naphthyridin-4-yl]ethynyl]phenoxy]azetidin-1-yl]ethanone (PubChem CID 170627442) has the molecular formula C22H21N5O2 and a molecular weight of 387.44 g/mol. Its IUPAC name is 1-[3-[4-[2-[6-amino-1-(methylamino)-2,7-naphthyridin-4-yl]ethynyl]phenoxy]azetidin-1-yl]ethanone.
| Compound Name | 1-[3-[4-[2-[6-amino-1-(methylamino)-2,7-naphthyridin-4-yl]ethynyl]phenoxy]azetidin-1-yl]ethanone |
|---|---|
| PubChem CID | 170627442 |
| Molecular Formula | C22H21N5O2 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 1-[3-[4-[2-[6-amino-1-(methylamino)-2,7-naphthyridin-4-yl]ethynyl]phenoxy]azetidin-1-yl]ethanone |
| SMILES | CNc1ncc(C#Cc2ccc(OC3CN(C(C)=O)C3)cc2)c2cc(N)ncc12 |
| InChI | InChI=1S/C22H21N5O2/c1-14(28)27-12-18(13-27)29-17-7-4-15(5-8-17)3-6-16-10-26-22(24-2)20-11-25-21(23)9-19(16)20/h4-5,7-11,18H,12-13H2,1-2H3,(H2,23,25)(H,24,26) |
| InChIKey | ITRDJPUKZOFEDB-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|