About N,5-diethyl-N-methyl-3,4-dihydropyridin-6-amine;ethane
N,5-diethyl-N-methyl-3,4-dihydropyridin-6-amine;ethane (PubChem CID 170628659) has the molecular formula C12H24N2
and a molecular weight of 196.34 g/mol. Its IUPAC name is N,5-diethyl-N-methyl-3,4-dihydropyridin-6-amine;ethane.
Molecular Properties
| Compound Name | N,5-diethyl-N-methyl-3,4-dihydropyridin-6-amine;ethane |
| PubChem CID | 170628659 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | N,5-diethyl-N-methyl-3,4-dihydropyridin-6-amine;ethane |
| SMILES | CC.CCC1=C(N(C)CC)N=CCC1 |
| InChI | InChI=1S/C10H18N2.C2H6/c1-4-9-7-6-8-11-10(9)12(3)5-2;1-2/h8H,4-7H2,1-3H3;1-2H3 |
| InChIKey | PODNQHLXFXSVID-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,5-diethyl-N-methyl-3,4-dihydropyridin-6-amine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,5-diethyl-N-methyl-3,4-dihydropyridin-6-amine;ethane?
The IUPAC name of N,5-diethyl-N-methyl-3,4-dihydropyridin-6-amine;ethane (CID 170628659) is N,5-diethyl-N-methyl-3,4-dihydropyridin-6-amine;ethane.
What is the SMILES notation for N,5-diethyl-N-methyl-3,4-dihydropyridin-6-amine;ethane?
The canonical SMILES for N,5-diethyl-N-methyl-3,4-dihydropyridin-6-amine;ethane is CC.CCC1=C(N(C)CC)N=CCC1.
What is the InChIKey of N,5-diethyl-N-methyl-3,4-dihydropyridin-6-amine;ethane?
The InChIKey is PODNQHLXFXSVID-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2.C2H6/c1-4-9-7-6-8-11-10(9)12(3)5-2;1-2/h8H,4-7H2,1-3H3;1-2H3.
What are the key properties of N,5-diethyl-N-methyl-3,4-dihydropyridin-6-amine;ethane?
N,5-diethyl-N-methyl-3,4-dihydropyridin-6-amine;ethane has a molecular weight of 196.34 g/mol, XLogP of 3.45, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,5-diethyl-N-methyl-3,4-dihydropyridin-6-amine;ethane is sourced from PubChem (CID 170628659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).