C10H12FNO — CID 170628668
(2R)-4-fluoro-2-(methoxymethyl)-2,3-dihydro-1H-indole (PubChem CID 170628668) has the molecular formula C10H12FNO and a molecular weight of 181.21 g/mol. Its IUPAC name is (2R)-4-fluoro-2-(methoxymethyl)-2,3-dihydro-1H-indole.
| Compound Name | (2R)-4-fluoro-2-(methoxymethyl)-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 170628668 |
| Molecular Formula | C10H12FNO |
| Molecular Weight | 181.21 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | (2R)-4-fluoro-2-(methoxymethyl)-2,3-dihydro-1H-indole |
| SMILES | COC[C@H]1Cc2c(F)cccc2N1 |
| InChI | InChI=1S/C10H12FNO/c1-13-6-7-5-8-9(11)3-2-4-10(8)12-7/h2-4,7,12H,5-6H2,1H3/t7-/m1/s1 |
| InChIKey | UHLQRBQQMQXQII-SSDOTTSWSA-N |
| XLogP | 1.81 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.21 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |