About azane;fluoroform;2-propan-2-yl-2-azaspiro[3.5]nonane
azane;fluoroform;2-propan-2-yl-2-azaspiro[3.5]nonane (PubChem CID 170629279) has the molecular formula C12H25F3N2
and a molecular weight of 254.34 g/mol. Its IUPAC name is azane;fluoroform;2-propan-2-yl-2-azaspiro[3.5]nonane.
Molecular Properties
| Compound Name | azane;fluoroform;2-propan-2-yl-2-azaspiro[3.5]nonane |
| PubChem CID | 170629279 |
| Molecular Formula | C12H25F3N2 |
| Molecular Weight | 254.34 g/mol |
| Exact Mass | 254.20 |
| IUPAC Name | azane;fluoroform;2-propan-2-yl-2-azaspiro[3.5]nonane |
| SMILES | CC(C)N1CC2(CCCCC2)C1.FC(F)F.N |
| InChI | InChI=1S/C11H21N.CHF3.H3N/c1-10(2)12-8-11(9-12)6-4-3-5-7-11;2-1(3)4;/h10H,3-9H2,1-2H3;1H;1H3 |
| InChIKey | WUKAQGLRPQTZJS-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 38.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.34 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze azane;fluoroform;2-propan-2-yl-2-azaspiro[3.5]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;fluoroform;2-propan-2-yl-2-azaspiro[3.5]nonane?
The IUPAC name of azane;fluoroform;2-propan-2-yl-2-azaspiro[3.5]nonane (CID 170629279) is azane;fluoroform;2-propan-2-yl-2-azaspiro[3.5]nonane.
What is the SMILES notation for azane;fluoroform;2-propan-2-yl-2-azaspiro[3.5]nonane?
The canonical SMILES for azane;fluoroform;2-propan-2-yl-2-azaspiro[3.5]nonane is CC(C)N1CC2(CCCCC2)C1.FC(F)F.N.
What is the InChIKey of azane;fluoroform;2-propan-2-yl-2-azaspiro[3.5]nonane?
The InChIKey is WUKAQGLRPQTZJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N.CHF3.H3N/c1-10(2)12-8-11(9-12)6-4-3-5-7-11;2-1(3)4;/h10H,3-9H2,1-2H3;1H;1H3.
What are the key properties of azane;fluoroform;2-propan-2-yl-2-azaspiro[3.5]nonane?
azane;fluoroform;2-propan-2-yl-2-azaspiro[3.5]nonane has a molecular weight of 254.34 g/mol, XLogP of 4.00, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azane;fluoroform;2-propan-2-yl-2-azaspiro[3.5]nonane is sourced from PubChem (CID 170629279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).