About 3-[(2,2-dimethyl-4-propan-2-ylpiperazin-1-yl)methyl]-N-methylhexan-1-amine;ethane
3-[(2,2-dimethyl-4-propan-2-ylpiperazin-1-yl)methyl]-N-methylhexan-1-amine;ethane (PubChem CID 170629385) has the molecular formula C19H43N3
and a molecular weight of 313.57 g/mol. Its IUPAC name is 3-[(2,2-dimethyl-4-propan-2-ylpiperazin-1-yl)methyl]-N-methylhexan-1-amine;ethane.
Molecular Properties
| Compound Name | 3-[(2,2-dimethyl-4-propan-2-ylpiperazin-1-yl)methyl]-N-methylhexan-1-amine;ethane |
| PubChem CID | 170629385 |
| Molecular Formula | C19H43N3 |
| Molecular Weight | 313.57 g/mol |
| Exact Mass | 313.35 |
| IUPAC Name | 3-[(2,2-dimethyl-4-propan-2-ylpiperazin-1-yl)methyl]-N-methylhexan-1-amine;ethane |
| SMILES | CC.CCCC(CCNC)CN1CCN(C(C)C)CC1(C)C |
| InChI | InChI=1S/C17H37N3.C2H6/c1-7-8-16(9-10-18-6)13-20-12-11-19(15(2)3)14-17(20,4)5;1-2/h15-16,18H,7-14H2,1-6H3;1-2H3 |
| InChIKey | VNPXJXPPIOMNAF-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.57 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(2,2-dimethyl-4-propan-2-ylpiperazin-1-yl)methyl]-N-methylhexan-1-amine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2,2-dimethyl-4-propan-2-ylpiperazin-1-yl)methyl]-N-methylhexan-1-amine;ethane?
The IUPAC name of 3-[(2,2-dimethyl-4-propan-2-ylpiperazin-1-yl)methyl]-N-methylhexan-1-amine;ethane (CID 170629385) is 3-[(2,2-dimethyl-4-propan-2-ylpiperazin-1-yl)methyl]-N-methylhexan-1-amine;ethane.
What is the SMILES notation for 3-[(2,2-dimethyl-4-propan-2-ylpiperazin-1-yl)methyl]-N-methylhexan-1-amine;ethane?
The canonical SMILES for 3-[(2,2-dimethyl-4-propan-2-ylpiperazin-1-yl)methyl]-N-methylhexan-1-amine;ethane is CC.CCCC(CCNC)CN1CCN(C(C)C)CC1(C)C.
What is the InChIKey of 3-[(2,2-dimethyl-4-propan-2-ylpiperazin-1-yl)methyl]-N-methylhexan-1-amine;ethane?
The InChIKey is VNPXJXPPIOMNAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H37N3.C2H6/c1-7-8-16(9-10-18-6)13-20-12-11-19(15(2)3)14-17(20,4)5;1-2/h15-16,18H,7-14H2,1-6H3;1-2H3.
What are the key properties of 3-[(2,2-dimethyl-4-propan-2-ylpiperazin-1-yl)methyl]-N-methylhexan-1-amine;ethane?
3-[(2,2-dimethyl-4-propan-2-ylpiperazin-1-yl)methyl]-N-methylhexan-1-amine;ethane has a molecular weight of 313.57 g/mol, XLogP of 3.84, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,2-dimethyl-4-propan-2-ylpiperazin-1-yl)methyl]-N-methylhexan-1-amine;ethane is sourced from PubChem (CID 170629385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).