C25H29FN4O3 — CID 170630086
6-[7-[(3S)-3-fluoro-2,2,6,6-tetramethylpiperidin-4-yl]-5,6-dihydropyrrolo[2,3-c]pyridazin-3-yl]-7-hydroxy-4-methylchromen-2-one (PubChem CID 170630086) has the molecular formula C25H29FN4O3 and a molecular weight of 452.53 g/mol. Its IUPAC name is 6-[7-[(3S)-3-fluoro-2,2,6,6-tetramethylpiperidin-4-yl]-5,6-dihydropyrrolo[2,3-c]pyridazin-3-yl]-7-hydroxy-4-methylchromen-2-one.
| Compound Name | 6-[7-[(3S)-3-fluoro-2,2,6,6-tetramethylpiperidin-4-yl]-5,6-dihydropyrrolo[2,3-c]pyridazin-3-yl]-7-hydroxy-4-methylchromen-2-one |
|---|---|
| PubChem CID | 170630086 |
| Molecular Formula | C25H29FN4O3 |
| Molecular Weight | 452.53 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | 6-[7-[(3S)-3-fluoro-2,2,6,6-tetramethylpiperidin-4-yl]-5,6-dihydropyrrolo[2,3-c]pyridazin-3-yl]-7-hydroxy-4-methylchromen-2-one |
| SMILES | Cc1cc(=O)oc2cc(O)c(-c3cc4c(nn3)N(C3CC(C)(C)NC(C)(C)[C@H]3F)CC4)cc12 |
| InChI | InChI=1S/C25H29FN4O3/c1-13-8-21(32)33-20-11-19(31)16(10-15(13)20)17-9-14-6-7-30(23(14)28-27-17)18-12-24(2,3)29-25(4,5)22(18)26/h8-11,18,22,29,31H,6-7,12H2,1-5H3/t18?,22-/m0/s1 |
| InChIKey | BEMCWKQUJKABCJ-YSYXNDDBSA-N |
| XLogP | 3.88 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.53 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|