C9H14FN — CID 170630177
(4E)-5-fluoro-2,6-dimethylhepta-2,4,6-trien-3-amine (PubChem CID 170630177) has the molecular formula C9H14FN and a molecular weight of 155.22 g/mol. Its IUPAC name is (4E)-5-fluoro-2,6-dimethylhepta-2,4,6-trien-3-amine.
| Compound Name | (4E)-5-fluoro-2,6-dimethylhepta-2,4,6-trien-3-amine |
|---|---|
| PubChem CID | 170630177 |
| Molecular Formula | C9H14FN |
| Molecular Weight | 155.22 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | (4E)-5-fluoro-2,6-dimethylhepta-2,4,6-trien-3-amine |
| SMILES | C=C(C)/C(F)=C\C(N)=C(C)C |
| InChI | InChI=1S/C9H14FN/c1-6(2)8(10)5-9(11)7(3)4/h5H,1,11H2,2-4H3/b8-5+ |
| InChIKey | DLUOOFPXKZFQEF-VMPITWQZSA-N |
| XLogP | 2.67 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.22 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|