C14H30N2O3 — CID 170631614
azane;3,3-dimethyl-1-(3,3,4-trimethylpyrrolidin-1-yl)butan-1-one;formic acid (PubChem CID 170631614) has the molecular formula C14H30N2O3 and a molecular weight of 274.40 g/mol. Its IUPAC name is azane;3,3-dimethyl-1-(3,3,4-trimethylpyrrolidin-1-yl)butan-1-one;formic acid.
| Compound Name | azane;3,3-dimethyl-1-(3,3,4-trimethylpyrrolidin-1-yl)butan-1-one;formic acid |
|---|---|
| PubChem CID | 170631614 |
| Molecular Formula | C14H30N2O3 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.23 |
| IUPAC Name | azane;3,3-dimethyl-1-(3,3,4-trimethylpyrrolidin-1-yl)butan-1-one;formic acid |
| SMILES | CC1CN(C(=O)CC(C)(C)C)CC1(C)C.N.O=CO |
| InChI | InChI=1S/C13H25NO.CH2O2.H3N/c1-10-8-14(9-13(10,5)6)11(15)7-12(2,3)4;2-1-3;/h10H,7-9H2,1-6H3;1H,(H,2,3);1H3 |
| InChIKey | LASQUHZGJSQZKC-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 92.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|