About tert-butyl N-[1-amino-1-oxo-3-(triazol-1-yl)propan-2-yl]carbamate;ethane
tert-butyl N-[1-amino-1-oxo-3-(triazol-1-yl)propan-2-yl]carbamate;ethane (PubChem CID 170631702) has the molecular formula C12H23N5O3
and a molecular weight of 285.35 g/mol. Its IUPAC name is tert-butyl N-[1-amino-1-oxo-3-(triazol-1-yl)propan-2-yl]carbamate;ethane.
Molecular Properties
| Compound Name | tert-butyl N-[1-amino-1-oxo-3-(triazol-1-yl)propan-2-yl]carbamate;ethane |
| PubChem CID | 170631702 |
| Molecular Formula | C12H23N5O3 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | tert-butyl N-[1-amino-1-oxo-3-(triazol-1-yl)propan-2-yl]carbamate;ethane |
| SMILES | CC.CC(C)(C)OC(=O)NC(Cn1ccnn1)C(N)=O |
| InChI | InChI=1S/C10H17N5O3.C2H6/c1-10(2,3)18-9(17)13-7(8(11)16)6-15-5-4-12-14-15;1-2/h4-5,7H,6H2,1-3H3,(H2,11,16)(H,13,17);1-2H3 |
| InChIKey | LAURTSZVLLIPFH-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 112.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tert-butyl N-[1-amino-1-oxo-3-(triazol-1-yl)propan-2-yl]carbamate;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[1-amino-1-oxo-3-(triazol-1-yl)propan-2-yl]carbamate;ethane?
The IUPAC name of tert-butyl N-[1-amino-1-oxo-3-(triazol-1-yl)propan-2-yl]carbamate;ethane (CID 170631702) is tert-butyl N-[1-amino-1-oxo-3-(triazol-1-yl)propan-2-yl]carbamate;ethane.
What is the SMILES notation for tert-butyl N-[1-amino-1-oxo-3-(triazol-1-yl)propan-2-yl]carbamate;ethane?
The canonical SMILES for tert-butyl N-[1-amino-1-oxo-3-(triazol-1-yl)propan-2-yl]carbamate;ethane is CC.CC(C)(C)OC(=O)NC(Cn1ccnn1)C(N)=O.
What is the InChIKey of tert-butyl N-[1-amino-1-oxo-3-(triazol-1-yl)propan-2-yl]carbamate;ethane?
The InChIKey is LAURTSZVLLIPFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N5O3.C2H6/c1-10(2,3)18-9(17)13-7(8(11)16)6-15-5-4-12-14-15;1-2/h4-5,7H,6H2,1-3H3,(H2,11,16)(H,13,17);1-2H3.
What are the key properties of tert-butyl N-[1-amino-1-oxo-3-(triazol-1-yl)propan-2-yl]carbamate;ethane?
tert-butyl N-[1-amino-1-oxo-3-(triazol-1-yl)propan-2-yl]carbamate;ethane has a molecular weight of 285.35 g/mol, XLogP of 0.68, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[1-amino-1-oxo-3-(triazol-1-yl)propan-2-yl]carbamate;ethane is sourced from PubChem (CID 170631702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).