C27H44N6O5S — CID 170631765
N-[1-cyano-2-(6-methyl-2-oxo-1,5,7,8-tetrahydro-1,6-naphthyridin-3-yl)ethyl]formamide;1-[(5S)-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-3,3-dimethylbutan-1-one;methanesulfonamide (PubChem CID 170631765) has the molecular formula C27H44N6O5S and a molecular weight of 564.75 g/mol. Its IUPAC name is N-[1-cyano-2-(6-methyl-2-oxo-1,5,7,8-tetrahydro-1,6-naphthyridin-3-yl)ethyl]formamide;1-[(5S)-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-3,3-dimethylbutan-1-one;methanesulfonamide.
| Compound Name | N-[1-cyano-2-(6-methyl-2-oxo-1,5,7,8-tetrahydro-1,6-naphthyridin-3-yl)ethyl]formamide;1-[(5S)-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-3,3-dimethylbutan-1-one;methanesulfonamide |
|---|---|
| PubChem CID | 170631765 |
| Molecular Formula | C27H44N6O5S |
| Molecular Weight | 564.75 g/mol |
| Exact Mass | 564.31 |
| IUPAC Name | N-[1-cyano-2-(6-methyl-2-oxo-1,5,7,8-tetrahydro-1,6-naphthyridin-3-yl)ethyl]formamide;1-[(5S)-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-3,3-dimethylbutan-1-one;methanesulfonamide |
| SMILES | CC(C)(C)CC(=O)N1CC2[C@H](C1)C2(C)C.CN1CCc2[nH]c(=O)c(CC(C#N)NC=O)cc2C1.CS(N)(=O)=O |
| InChI | InChI=1S/C13H16N4O2.C13H23NO.CH5NO2S/c1-17-3-2-12-10(7-17)4-9(13(19)16-12)5-11(6-14)15-8-18;1-12(2,3)6-11(15)14-7-9-10(8-14)13(9,4)5;1-5(2,3)4/h4,8,11H,2-3,5,7H2,1H3,(H,15,18)(H,16,19);9-10H,6-8H2,1-5H3;1H3,(H2,2,3,4)/t;9-,10?;/m.0./s1 |
| InChIKey | OPWXGXJKMLALHH-KDDYDKPPSA-N |
| XLogP | 0.99 |
| TPSA | 169.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.75 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|