C19H27F3N4O — CID 170631987
(2S)-3,3-dimethyl-2-[[2-(trifluoromethyl)pyrimidin-4-yl]amino]-1-[(1R,2R,5S)-2,6,6-trimethyl-3-azabicyclo[3.1.0]hexan-3-yl]butan-1-one (PubChem CID 170631987) has the molecular formula C19H27F3N4O and a molecular weight of 384.45 g/mol. Its IUPAC name is (2S)-3,3-dimethyl-2-[[2-(trifluoromethyl)pyrimidin-4-yl]amino]-1-[(1R,2R,5S)-2,6,6-trimethyl-3-azabicyclo[3.1.0]hexan-3-yl]butan-1-one.
| Compound Name | (2S)-3,3-dimethyl-2-[[2-(trifluoromethyl)pyrimidin-4-yl]amino]-1-[(1R,2R,5S)-2,6,6-trimethyl-3-azabicyclo[3.1.0]hexan-3-yl]butan-1-one |
|---|---|
| PubChem CID | 170631987 |
| Molecular Formula | C19H27F3N4O |
| Molecular Weight | 384.45 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | (2S)-3,3-dimethyl-2-[[2-(trifluoromethyl)pyrimidin-4-yl]amino]-1-[(1R,2R,5S)-2,6,6-trimethyl-3-azabicyclo[3.1.0]hexan-3-yl]butan-1-one |
| SMILES | C[C@@H]1[C@@H]2[C@H](CN1C(=O)[C@@H](Nc1ccnc(C(F)(F)F)n1)C(C)(C)C)C2(C)C |
| InChI | InChI=1S/C19H27F3N4O/c1-10-13-11(18(13,5)6)9-26(10)15(27)14(17(2,3)4)24-12-7-8-23-16(25-12)19(20,21)22/h7-8,10-11,13-14H,9H2,1-6H3,(H,23,24,25)/t10-,11+,13-,14-/m1/s1 |
| InChIKey | LIXQCTGEZKWWND-ZMJPVWNMSA-N |
| XLogP | 3.82 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.45 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |