C28H28N2O2S — CID 17063202
9-(4-ethoxyphenyl)-6-(4-methylsulfanylphenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one (PubChem CID 17063202) has the molecular formula C28H28N2O2S and a molecular weight of 456.61 g/mol. Its IUPAC name is 9-(4-ethoxyphenyl)-6-(4-methylsulfanylphenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one.
| Compound Name | 9-(4-ethoxyphenyl)-6-(4-methylsulfanylphenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 17063202 |
| Molecular Formula | C28H28N2O2S |
| Molecular Weight | 456.61 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | 9-(4-ethoxyphenyl)-6-(4-methylsulfanylphenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
| SMILES | CCOc1ccc(C2CC(=O)C3=C(C2)Nc2ccccc2NC3c2ccc(SC)cc2)cc1 |
| InChI | InChI=1S/C28H28N2O2S/c1-3-32-21-12-8-18(9-13-21)20-16-25-27(26(31)17-20)28(19-10-14-22(33-2)15-11-19)30-24-7-5-4-6-23(24)29-25/h4-15,20,28-30H,3,16-17H2,1-2H3 |
| InChIKey | AGTVHFHDXLFRGP-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.61 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |