C19H25F3N4O3 — CID 170632031
(1R,2S,5S)-3-[(2S)-3,3-dimethyl-2-[[2-(trifluoromethyl)pyrimidin-4-yl]amino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylic acid (PubChem CID 170632031) has the molecular formula C19H25F3N4O3 and a molecular weight of 414.43 g/mol. Its IUPAC name is (1R,2S,5S)-3-[(2S)-3,3-dimethyl-2-[[2-(trifluoromethyl)pyrimidin-4-yl]amino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylic acid.
| Compound Name | (1R,2S,5S)-3-[(2S)-3,3-dimethyl-2-[[2-(trifluoromethyl)pyrimidin-4-yl]amino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylic acid |
|---|---|
| PubChem CID | 170632031 |
| Molecular Formula | C19H25F3N4O3 |
| Molecular Weight | 414.43 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | (1R,2S,5S)-3-[(2S)-3,3-dimethyl-2-[[2-(trifluoromethyl)pyrimidin-4-yl]amino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylic acid |
| SMILES | CC(C)(C)[C@H](Nc1ccnc(C(F)(F)F)n1)C(=O)N1C[C@H]2[C@@H]([C@H]1C(=O)O)C2(C)C |
| InChI | InChI=1S/C19H25F3N4O3/c1-17(2,3)13(24-10-6-7-23-16(25-10)19(20,21)22)14(27)26-8-9-11(18(9,4)5)12(26)15(28)29/h6-7,9,11-13H,8H2,1-5H3,(H,28,29)(H,23,24,25)/t9-,11-,12-,13+/m0/s1 |
| InChIKey | LYZFCWLGZKNWMD-XYJRDEOASA-N |
| XLogP | 2.89 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.43 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |