C13H15F2N3O3 — CID 170632176
3-(6,6-difluoro-2-oxo-1,5,7,8-tetrahydroquinolin-3-yl)-2-formamidopropanamide (PubChem CID 170632176) has the molecular formula C13H15F2N3O3 and a molecular weight of 299.28 g/mol. Its IUPAC name is 3-(6,6-difluoro-2-oxo-1,5,7,8-tetrahydroquinolin-3-yl)-2-formamidopropanamide.
| Compound Name | 3-(6,6-difluoro-2-oxo-1,5,7,8-tetrahydroquinolin-3-yl)-2-formamidopropanamide |
|---|---|
| PubChem CID | 170632176 |
| Molecular Formula | C13H15F2N3O3 |
| Molecular Weight | 299.28 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | 3-(6,6-difluoro-2-oxo-1,5,7,8-tetrahydroquinolin-3-yl)-2-formamidopropanamide |
| SMILES | NC(=O)C(Cc1cc2c([nH]c1=O)CCC(F)(F)C2)NC=O |
| InChI | InChI=1S/C13H15F2N3O3/c14-13(15)2-1-9-8(5-13)3-7(12(21)18-9)4-10(11(16)20)17-6-19/h3,6,10H,1-2,4-5H2,(H2,16,20)(H,17,19)(H,18,21) |
| InChIKey | IXVQIJNTTWHEJE-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 105.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.28 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|